C17H22N4O2 — CID 94032780
(2S)-3-methyl-2-[(2-phenylacetyl)amino]-N-(1H-pyrazol-5-ylmethyl)butanamide (PubChem CID 94032780) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is (2S)-3-methyl-2-[(2-phenylacetyl)amino]-N-(1H-pyrazol-5-ylmethyl)butanamide.
| Compound Name | (2S)-3-methyl-2-[(2-phenylacetyl)amino]-N-(1H-pyrazol-5-ylmethyl)butanamide |
|---|---|
| PubChem CID | 94032780 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (2S)-3-methyl-2-[(2-phenylacetyl)amino]-N-(1H-pyrazol-5-ylmethyl)butanamide |
| SMILES | CC(C)[C@H](NC(=O)Cc1ccccc1)C(=O)NCc1ccn[nH]1 |
| InChI | InChI=1S/C17H22N4O2/c1-12(2)16(17(23)18-11-14-8-9-19-21-14)20-15(22)10-13-6-4-3-5-7-13/h3-9,12,16H,10-11H2,1-2H3,(H,18,23)(H,19,21)(H,20,22)/t16-/m0/s1 |
| InChIKey | AGRCRDOTIPFUIJ-INIZCTEOSA-N |
| XLogP | 1.41 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |