C17H25N3O3 — CID 17471911
N-[2-(ethylamino)-2-oxoethyl]-3-methyl-2-[(2-phenylacetyl)amino]butanamide (PubChem CID 17471911) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is N-[2-(ethylamino)-2-oxoethyl]-3-methyl-2-[(2-phenylacetyl)amino]butanamide.
| Compound Name | N-[2-(ethylamino)-2-oxoethyl]-3-methyl-2-[(2-phenylacetyl)amino]butanamide |
|---|---|
| PubChem CID | 17471911 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | N-[2-(ethylamino)-2-oxoethyl]-3-methyl-2-[(2-phenylacetyl)amino]butanamide |
| SMILES | CCNC(=O)CNC(=O)C(NC(=O)Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C17H25N3O3/c1-4-18-15(22)11-19-17(23)16(12(2)3)20-14(21)10-13-8-6-5-7-9-13/h5-9,12,16H,4,10-11H2,1-3H3,(H,18,22)(H,19,23)(H,20,21) |
| InChIKey | FPZUJTMFQPCUBT-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |