C21H28ClN3O2 — CID 119527674
N-(2-amino-2-phenylethyl)-3-methyl-2-[(2-phenylacetyl)amino]butanamide;hydrochloride (PubChem CID 119527674) has the molecular formula C21H28ClN3O2 and a molecular weight of 389.93 g/mol. Its IUPAC name is N-(2-amino-2-phenylethyl)-3-methyl-2-[(2-phenylacetyl)amino]butanamide;hydrochloride.
| Compound Name | N-(2-amino-2-phenylethyl)-3-methyl-2-[(2-phenylacetyl)amino]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119527674 |
| Molecular Formula | C21H28ClN3O2 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | N-(2-amino-2-phenylethyl)-3-methyl-2-[(2-phenylacetyl)amino]butanamide;hydrochloride |
| SMILES | CC(C)C(NC(=O)Cc1ccccc1)C(=O)NCC(N)c1ccccc1.Cl |
| InChI | InChI=1S/C21H27N3O2.ClH/c1-15(2)20(24-19(25)13-16-9-5-3-6-10-16)21(26)23-14-18(22)17-11-7-4-8-12-17;/h3-12,15,18,20H,13-14,22H2,1-2H3,(H,23,26)(H,24,25);1H |
| InChIKey | YEMJQZBAMZVAPB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |