C21H24BrN3O3 — CID 17475044
N-[2-(2-bromoanilino)-2-oxoethyl]-3-methyl-2-[(2-phenylacetyl)amino]butanamide (PubChem CID 17475044) has the molecular formula C21H24BrN3O3 and a molecular weight of 446.35 g/mol. Its IUPAC name is N-[2-(2-bromoanilino)-2-oxoethyl]-3-methyl-2-[(2-phenylacetyl)amino]butanamide.
| Compound Name | N-[2-(2-bromoanilino)-2-oxoethyl]-3-methyl-2-[(2-phenylacetyl)amino]butanamide |
|---|---|
| PubChem CID | 17475044 |
| Molecular Formula | C21H24BrN3O3 |
| Molecular Weight | 446.35 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | N-[2-(2-bromoanilino)-2-oxoethyl]-3-methyl-2-[(2-phenylacetyl)amino]butanamide |
| SMILES | CC(C)C(NC(=O)Cc1ccccc1)C(=O)NCC(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C21H24BrN3O3/c1-14(2)20(25-18(26)12-15-8-4-3-5-9-15)21(28)23-13-19(27)24-17-11-7-6-10-16(17)22/h3-11,14,20H,12-13H2,1-2H3,(H,23,28)(H,24,27)(H,25,26) |
| InChIKey | RNPPAEXVRRKKQO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |