C5H8N4O — CID 4196186
2-(1H-pyrazol-5-yl)acetohydrazide (PubChem CID 4196186) has the molecular formula C5H8N4O and a molecular weight of 140.15 g/mol. Its IUPAC name is 2-(1H-pyrazol-5-yl)acetohydrazide.
| Compound Name | 2-(1H-pyrazol-5-yl)acetohydrazide |
|---|---|
| PubChem CID | 4196186 |
| Molecular Formula | C5H8N4O |
| Molecular Weight | 140.15 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | 2-(1H-pyrazol-5-yl)acetohydrazide |
| SMILES | NNC(=O)Cc1ccn[nH]1 |
| InChI | InChI=1S/C5H8N4O/c6-8-5(10)3-4-1-2-7-9-4/h1-2H,3,6H2,(H,7,9)(H,8,10) |
| InChIKey | SSITUPYZZXZPCE-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.15 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|