C11H9Cl2N3O2 — CID 75523474
N-(3,5-dichloro-4-hydroxyphenyl)-2-(1H-pyrazol-5-yl)acetamide (PubChem CID 75523474) has the molecular formula C11H9Cl2N3O2 and a molecular weight of 286.12 g/mol. Its IUPAC name is N-(3,5-dichloro-4-hydroxyphenyl)-2-(1H-pyrazol-5-yl)acetamide.
| Compound Name | N-(3,5-dichloro-4-hydroxyphenyl)-2-(1H-pyrazol-5-yl)acetamide |
|---|---|
| PubChem CID | 75523474 |
| Molecular Formula | C11H9Cl2N3O2 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | N-(3,5-dichloro-4-hydroxyphenyl)-2-(1H-pyrazol-5-yl)acetamide |
| SMILES | O=C(Cc1ccn[nH]1)Nc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C11H9Cl2N3O2/c12-8-3-7(4-9(13)11(8)18)15-10(17)5-6-1-2-14-16-6/h1-4,18H,5H2,(H,14,16)(H,15,17) |
| InChIKey | CZTOUMCQQDZSMH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|