C13H21NO6 — CID 175358784
8-[(2-methylpropan-2-yl)oxycarbonylamino]oxy-8-oxooct-4-enoic acid (PubChem CID 175358784) has the molecular formula C13H21NO6 and a molecular weight of 287.31 g/mol. Its IUPAC name is 8-[(2-methylpropan-2-yl)oxycarbonylamino]oxy-8-oxooct-4-enoic acid.
| Compound Name | 8-[(2-methylpropan-2-yl)oxycarbonylamino]oxy-8-oxooct-4-enoic acid |
|---|---|
| PubChem CID | 175358784 |
| Molecular Formula | C13H21NO6 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 8-[(2-methylpropan-2-yl)oxycarbonylamino]oxy-8-oxooct-4-enoic acid |
| SMILES | CC(C)(C)OC(=O)NOC(=O)CCC=CCCC(=O)O |
| InChI | InChI=1S/C13H21NO6/c1-13(2,3)19-12(18)14-20-11(17)9-7-5-4-6-8-10(15)16/h4-5H,6-9H2,1-3H3,(H,14,18)(H,15,16) |
| InChIKey | VTHNYFGPDYDUSK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|