C63H115NO8 — CID 174174979
(9Z,30Z)-20-[(2-methylpropan-2-yl)oxycarbonylamino]-20-[[(Z)-octadec-9-enoyl]oxymethyl]nonatriaconta-9,30-dienedioic acid (PubChem CID 174174979) has the molecular formula C63H115NO8 and a molecular weight of 1014.61 g/mol. Its IUPAC name is (9Z,30Z)-20-[(2-methylpropan-2-yl)oxycarbonylamino]-20-[[(Z)-octadec-9-enoyl]oxymethyl]nonatriaconta-9,30-dienedioic acid.
| Compound Name | (9Z,30Z)-20-[(2-methylpropan-2-yl)oxycarbonylamino]-20-[[(Z)-octadec-9-enoyl]oxymethyl]nonatriaconta-9,30-dienedioic acid |
|---|---|
| PubChem CID | 174174979 |
| Molecular Formula | C63H115NO8 |
| Molecular Weight | 1014.61 g/mol |
| Exact Mass | 1013.86 |
| IUPAC Name | (9Z,30Z)-20-[(2-methylpropan-2-yl)oxycarbonylamino]-20-[[(Z)-octadec-9-enoyl]oxymethyl]nonatriaconta-9,30-dienedioic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(CCCCCCCCC/C=C\CCCCCCCC(=O)O)(CCCCCCCCC/C=C\CCCCCCCC(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C63H115NO8/c1-5-6-7-8-9-10-11-12-17-24-29-34-39-44-49-54-60(69)71-57-63(64-61(70)72-62(2,3)4,55-50-45-40-35-30-25-20-15-13-18-22-27-32-37-42-47-52-58(65)66)56-51-46-41-36-31-26-21-16-14-19-23-28-33-38-43-48-53-59(67)68/h12-14,17-19H,5-11,15-16,20-57H2,1-4H3,(H,64,70)(H,65,66)(H,67,68)/b17-12-,18-13-,19-14- |
| InChIKey | QYKYEXRGKISWQF-QFFBRIPRSA-N |
| XLogP | 19.60 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1014.61 |
| LogP ≤ 5 | 19.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|