C5H9BO3 — CID 89141546
CID 89141546 (PubChem CID 89141546) has the molecular formula C5H9BO3 and a molecular weight of 127.94 g/mol.
| Compound Name | CID 89141546 |
|---|---|
| PubChem CID | 89141546 |
| Molecular Formula | C5H9BO3 |
| Molecular Weight | 127.94 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1OCC(OC)C1O |
| InChI | InChI=1S/C5H9BO3/c1-8-3-2-9-5(6)4(3)7/h3-5,7H,2H2,1H3/t3?,4?,5-/m1/s1 |
| InChIKey | QKXHEOPDPACBPC-ZAGMFXPOSA-N |
| XLogP | -1.11 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.94 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|