C9H18O5 — CID 10943643
(2R,3R,4S,5S)-4,5-dimethoxy-2-(methoxymethyl)oxan-3-ol (PubChem CID 10943643) has the molecular formula C9H18O5 and a molecular weight of 206.24 g/mol. Its IUPAC name is (2R,3R,4S,5S)-4,5-dimethoxy-2-(methoxymethyl)oxan-3-ol.
| Compound Name | (2R,3R,4S,5S)-4,5-dimethoxy-2-(methoxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 10943643 |
| Molecular Formula | C9H18O5 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | (2R,3R,4S,5S)-4,5-dimethoxy-2-(methoxymethyl)oxan-3-ol |
| SMILES | COC[C@H]1OC[C@H](OC)[C@@H](OC)[C@@H]1O |
| InChI | InChI=1S/C9H18O5/c1-11-4-6-8(10)9(13-3)7(12-2)5-14-6/h6-10H,4-5H2,1-3H3/t6-,7+,8-,9-/m1/s1 |
| InChIKey | FSHQSETZFKFJAM-BZNPZCIMSA-N |
| XLogP | -0.58 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |