C7H14O4 — CID 131019515
[(2S,3R,4S)-3,4-dimethoxyoxolan-2-yl]methanol (PubChem CID 131019515) has the molecular formula C7H14O4 and a molecular weight of 162.18 g/mol. Its IUPAC name is [(2S,3R,4S)-3,4-dimethoxyoxolan-2-yl]methanol.
| Compound Name | [(2S,3R,4S)-3,4-dimethoxyoxolan-2-yl]methanol |
|---|---|
| PubChem CID | 131019515 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | [(2S,3R,4S)-3,4-dimethoxyoxolan-2-yl]methanol |
| SMILES | CO[C@@H]1[C@@H](OC)CO[C@H]1CO |
| InChI | InChI=1S/C7H14O4/c1-9-6-4-11-5(3-8)7(6)10-2/h5-8H,3-4H2,1-2H3/t5-,6-,7-/m0/s1 |
| InChIKey | GIVUKBOWFSQYFI-ACZMJKKPSA-N |
| XLogP | -0.59 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |