C8H16O5 — CID 100993548
(3R,4R,5S,6S)-6-(hydroxymethyl)-4,5-dimethoxyoxan-3-ol (PubChem CID 100993548) has the molecular formula C8H16O5 and a molecular weight of 192.21 g/mol. Its IUPAC name is (3R,4R,5S,6S)-6-(hydroxymethyl)-4,5-dimethoxyoxan-3-ol.
| Compound Name | (3R,4R,5S,6S)-6-(hydroxymethyl)-4,5-dimethoxyoxan-3-ol |
|---|---|
| PubChem CID | 100993548 |
| Molecular Formula | C8H16O5 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | (3R,4R,5S,6S)-6-(hydroxymethyl)-4,5-dimethoxyoxan-3-ol |
| SMILES | CO[C@@H]1[C@H](OC)[C@H](O)CO[C@H]1CO |
| InChI | InChI=1S/C8H16O5/c1-11-7-5(10)4-13-6(3-9)8(7)12-2/h5-10H,3-4H2,1-2H3/t5-,6+,7-,8+/m1/s1 |
| InChIKey | NPABHCXWYRUDOQ-CWKFCGSDSA-N |
| XLogP | -1.23 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |