About [(2R,3R,4R)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] acetate
[(2R,3R,4R)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] acetate (PubChem CID 21336534) has the molecular formula C7H12O5
and a molecular weight of 176.17 g/mol. Its IUPAC name is [(2R,3R,4R)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] acetate.
Molecular Properties
| Compound Name | [(2R,3R,4R)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] acetate |
| PubChem CID | 21336534 |
| Molecular Formula | C7H12O5 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | [(2R,3R,4R)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](O)CO[C@@H]1CO |
| InChI | InChI=1S/C7H12O5/c1-4(9)12-7-5(10)3-11-6(7)2-8/h5-8,10H,2-3H2,1H3/t5-,6-,7-/m1/s1 |
| InChIKey | XHVRDZZIKTWCJP-FSDSQADBSA-N |
| XLogP | -1.33 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2R,3R,4R)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R,4R)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] acetate?
The IUPAC name of [(2R,3R,4R)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] acetate (CID 21336534) is [(2R,3R,4R)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] acetate.
What is the SMILES notation for [(2R,3R,4R)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] acetate?
The canonical SMILES for [(2R,3R,4R)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] acetate is CC(=O)O[C@@H]1[C@H](O)CO[C@@H]1CO.
What is the InChIKey of [(2R,3R,4R)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] acetate?
The InChIKey is XHVRDZZIKTWCJP-FSDSQADBSA-N. The full InChI is InChI=1S/C7H12O5/c1-4(9)12-7-5(10)3-11-6(7)2-8/h5-8,10H,2-3H2,1H3/t5-,6-,7-/m1/s1.
What are the key properties of [(2R,3R,4R)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] acetate?
[(2R,3R,4R)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] acetate has a molecular weight of 176.17 g/mol, XLogP of -1.33, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R,4R)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] acetate is sourced from PubChem (CID 21336534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).