C7H13N3O3 — CID 123348073
[(2R,3R,5R)-5-azido-3-methoxyoxan-2-yl]methanol (PubChem CID 123348073) has the molecular formula C7H13N3O3 and a molecular weight of 187.20 g/mol. Its IUPAC name is [(2R,3R,5R)-5-azido-3-methoxyoxan-2-yl]methanol.
| Compound Name | [(2R,3R,5R)-5-azido-3-methoxyoxan-2-yl]methanol |
|---|---|
| PubChem CID | 123348073 |
| Molecular Formula | C7H13N3O3 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | [(2R,3R,5R)-5-azido-3-methoxyoxan-2-yl]methanol |
| SMILES | CO[C@@H]1C[C@@H](N=[N+]=[N-])CO[C@@H]1CO |
| InChI | InChI=1S/C7H13N3O3/c1-12-6-2-5(9-10-8)4-13-7(6)3-11/h5-7,11H,2-4H2,1H3/t5-,6-,7-/m1/s1 |
| InChIKey | PPTKPQDBQJCNPX-FSDSQADBSA-N |
| XLogP | 0.46 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|