C8H16O5 — CID 146226308
6-(hydroxymethyl)-2,5-dimethoxyoxan-3-ol (PubChem CID 146226308) has the molecular formula C8H16O5 and a molecular weight of 192.21 g/mol. Its IUPAC name is 6-(hydroxymethyl)-2,5-dimethoxyoxan-3-ol.
| Compound Name | 6-(hydroxymethyl)-2,5-dimethoxyoxan-3-ol |
|---|---|
| PubChem CID | 146226308 |
| Molecular Formula | C8H16O5 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 6-(hydroxymethyl)-2,5-dimethoxyoxan-3-ol |
| SMILES | COC1CC(O)C(OC)OC1CO |
| InChI | InChI=1S/C8H16O5/c1-11-6-3-5(10)8(12-2)13-7(6)4-9/h5-10H,3-4H2,1-2H3 |
| InChIKey | SURQEXVILYPVPE-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |