C13H27N3O3Si — CID 174001100
[(2R,3R)-5-azido-3-methoxyoxan-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 174001100) has the molecular formula C13H27N3O3Si and a molecular weight of 301.46 g/mol. Its IUPAC name is [(2R,3R)-5-azido-3-methoxyoxan-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R)-5-azido-3-methoxyoxan-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 174001100 |
| Molecular Formula | C13H27N3O3Si |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | [(2R,3R)-5-azido-3-methoxyoxan-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CO[C@@H]1CC(N=[N+]=[N-])CO[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H27N3O3Si/c1-13(2,3)20(5,6)19-9-12-11(17-4)7-10(8-18-12)15-16-14/h10-12H,7-9H2,1-6H3/t10?,11-,12-/m1/s1 |
| InChIKey | DWHXYVMJWPYWQO-PQDIPPBSSA-N |
| XLogP | 3.49 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|