C24H52BrN3O4Si3 — CID 10555726
[(2R,3S,4S,5R,6R)-6-azido-5-bromo-3,4-bis(triethylsilyloxy)oxan-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 10555726) has the molecular formula C24H52BrN3O4Si3 and a molecular weight of 610.86 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-6-azido-5-bromo-3,4-bis(triethylsilyloxy)oxan-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3S,4S,5R,6R)-6-azido-5-bromo-3,4-bis(triethylsilyloxy)oxan-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10555726 |
| Molecular Formula | C24H52BrN3O4Si3 |
| Molecular Weight | 610.86 g/mol |
| Exact Mass | 609.24 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-6-azido-5-bromo-3,4-bis(triethylsilyloxy)oxan-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H](Br)[C@H](N=[N+]=[N-])O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C24H52BrN3O4Si3/c1-12-34(13-2,14-3)31-21-19(18-29-33(10,11)24(7,8)9)30-23(27-28-26)20(25)22(21)32-35(15-4,16-5)17-6/h19-23H,12-18H2,1-11H3/t19-,20-,21+,22-,23-/m1/s1 |
| InChIKey | ARFWMLLFQABSCT-XNBWIAOKSA-N |
| XLogP | 8.59 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.86 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|