C12H22BrN3O3Si — CID 11360512
(2R,4S,5S,6R)-4-azido-2-bromo-5-[tert-butyl(dimethyl)silyl]oxy-6-methyloxan-3-one (PubChem CID 11360512) has the molecular formula C12H22BrN3O3Si and a molecular weight of 364.32 g/mol. Its IUPAC name is (2R,4S,5S,6R)-4-azido-2-bromo-5-[tert-butyl(dimethyl)silyl]oxy-6-methyloxan-3-one.
| Compound Name | (2R,4S,5S,6R)-4-azido-2-bromo-5-[tert-butyl(dimethyl)silyl]oxy-6-methyloxan-3-one |
|---|---|
| PubChem CID | 11360512 |
| Molecular Formula | C12H22BrN3O3Si |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | (2R,4S,5S,6R)-4-azido-2-bromo-5-[tert-butyl(dimethyl)silyl]oxy-6-methyloxan-3-one |
| SMILES | C[C@H]1O[C@H](Br)C(=O)[C@@H](N=[N+]=[N-])[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H22BrN3O3Si/c1-7-10(19-20(5,6)12(2,3)4)8(15-16-14)9(17)11(13)18-7/h7-8,10-11H,1-6H3/t7-,8-,10-,11+/m1/s1 |
| InChIKey | NBEXGOABVISQPO-OYBPUVFXSA-N |
| XLogP | 3.76 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|