C19H39N3O5Si2 — CID 100984961
methyl (2R,3R,4S,5S)-2-azido-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyloxolane-2-carboxylate (PubChem CID 100984961) has the molecular formula C19H39N3O5Si2 and a molecular weight of 445.71 g/mol. Its IUPAC name is methyl (2R,3R,4S,5S)-2-azido-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyloxolane-2-carboxylate.
| Compound Name | methyl (2R,3R,4S,5S)-2-azido-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyloxolane-2-carboxylate |
|---|---|
| PubChem CID | 100984961 |
| Molecular Formula | C19H39N3O5Si2 |
| Molecular Weight | 445.71 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | methyl (2R,3R,4S,5S)-2-azido-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyloxolane-2-carboxylate |
| SMILES | COC(=O)[C@]1(N=[N+]=[N-])O[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H39N3O5Si2/c1-13-14(26-28(9,10)17(2,3)4)15(27-29(11,12)18(5,6)7)19(25-13,21-22-20)16(23)24-8/h13-15H,1-12H3/t13-,14-,15+,19+/m0/s1 |
| InChIKey | MPLPZBVGURGPEM-XTDOFWJNSA-N |
| XLogP | 5.37 |
| TPSA | 102.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.71 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|