C26H56N2O7Si3 — CID 10864888
methyl (2S,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(carbamoylamino)oxolane-2-carboxylate (PubChem CID 10864888) has the molecular formula C26H56N2O7Si3 and a molecular weight of 593.00 g/mol. Its IUPAC name is methyl (2S,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(carbamoylamino)oxolane-2-carboxylate.
| Compound Name | methyl (2S,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(carbamoylamino)oxolane-2-carboxylate |
|---|---|
| PubChem CID | 10864888 |
| Molecular Formula | C26H56N2O7Si3 |
| Molecular Weight | 593.00 g/mol |
| Exact Mass | 592.34 |
| IUPAC Name | methyl (2S,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(carbamoylamino)oxolane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(NC(N)=O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H56N2O7Si3/c1-23(2,3)36(11,12)32-17-18-19(34-37(13,14)24(4,5)6)20(35-38(15,16)25(7,8)9)26(33-18,21(29)31-10)28-22(27)30/h18-20H,17H2,1-16H3,(H3,27,28,30)/t18-,19-,20+,26+/m1/s1 |
| InChIKey | BUVJVNUWTPPETJ-CWAZBZNHSA-N |
| XLogP | 5.73 |
| TPSA | 118.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.00 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|