C25H53N3O6Si3 — CID 100984962
methyl (2S,3S,4R,5R)-2-azido-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolane-2-carboxylate (PubChem CID 100984962) has the molecular formula C25H53N3O6Si3 and a molecular weight of 575.97 g/mol. Its IUPAC name is methyl (2S,3S,4R,5R)-2-azido-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolane-2-carboxylate.
| Compound Name | methyl (2S,3S,4R,5R)-2-azido-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolane-2-carboxylate |
|---|---|
| PubChem CID | 100984962 |
| Molecular Formula | C25H53N3O6Si3 |
| Molecular Weight | 575.97 g/mol |
| Exact Mass | 575.32 |
| IUPAC Name | methyl (2S,3S,4R,5R)-2-azido-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(N=[N+]=[N-])O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H53N3O6Si3/c1-22(2,3)35(11,12)31-17-18-19(33-36(13,14)23(4,5)6)20(34-37(15,16)24(7,8)9)25(32-18,27-28-26)21(29)30-10/h18-20H,17H2,1-16H3/t18-,19-,20+,25+/m1/s1 |
| InChIKey | XBECQAJIPSYNGS-PUFAWVJESA-N |
| XLogP | 7.37 |
| TPSA | 111.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.97 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|