C22H44N4O9PSi+ — CID 172866032
[(2S,4R,5S,6R)-4,5-diacetyloxy-2-azido-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]oxy-hydroxy-oxophosphanium;N,N-diethylethanamine (PubChem CID 172866032) has the molecular formula C22H44N4O9PSi+ and a molecular weight of 567.67 g/mol. Its IUPAC name is [(2S,4R,5S,6R)-4,5-diacetyloxy-2-azido-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]oxy-hydroxy-oxophosphanium;N,N-diethylethanamine.
| Compound Name | [(2S,4R,5S,6R)-4,5-diacetyloxy-2-azido-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]oxy-hydroxy-oxophosphanium;N,N-diethylethanamine |
|---|---|
| PubChem CID | 172866032 |
| Molecular Formula | C22H44N4O9PSi+ |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | [(2S,4R,5S,6R)-4,5-diacetyloxy-2-azido-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]oxy-hydroxy-oxophosphanium;N,N-diethylethanamine |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)C[C@@](N=[N+]=[N-])(O[P+](=O)O)O[C@@H]1CO[Si](C)(C)C(C)(C)C.CCN(CC)CC |
| InChI | InChI=1S/C16H28N3O9PSi.C6H15N/c1-10(20)25-12-8-16(18-19-17,28-29(22)23)27-13(14(12)26-11(2)21)9-24-30(6,7)15(3,4)5;1-4-7(5-2)6-3/h12-14H,8-9H2,1-7H3;4-6H2,1-3H3/p+1/t12-,13-,14+,16+;/m1./s1 |
| InChIKey | PTOARKMFONZPLJ-BRRMJYQTSA-O |
| XLogP | 4.64 |
| TPSA | 169.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|