C20H41N3O6Si2 — CID 102474541
methyl (1S,2S,3R,4R,5R)-3-azido-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5-dihydroxycyclohexane-1-carboxylate (PubChem CID 102474541) has the molecular formula C20H41N3O6Si2 and a molecular weight of 475.74 g/mol. Its IUPAC name is methyl (1S,2S,3R,4R,5R)-3-azido-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5-dihydroxycyclohexane-1-carboxylate.
| Compound Name | methyl (1S,2S,3R,4R,5R)-3-azido-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5-dihydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 102474541 |
| Molecular Formula | C20H41N3O6Si2 |
| Molecular Weight | 475.74 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | methyl (1S,2S,3R,4R,5R)-3-azido-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5-dihydroxycyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@]1(O[Si](C)(C)C(C)(C)C)C[C@@H](O)[C@H](O)[C@@H](N=[N+]=[N-])[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H41N3O6Si2/c1-18(2,3)30(8,9)28-16-14(22-23-21)15(25)13(24)12-20(16,17(26)27-7)29-31(10,11)19(4,5)6/h13-16,24-25H,12H2,1-11H3/t13-,14-,15+,16+,20+/m1/s1 |
| InChIKey | SCLDWSNKYCUODD-OJOVYZNWSA-N |
| XLogP | 4.11 |
| TPSA | 133.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.74 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|