About trans-(2R,6S)-6-azido-2-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexan-1-ol
trans-(2R,6S)-6-azido-2-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexan-1-ol (PubChem CID 161192678) has the molecular formula C13H27N3O2Si
and a molecular weight of 285.46 g/mol. Its IUPAC name is trans-(2R,6S)-6-azido-2-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexan-1-ol.
Molecular Properties
| Compound Name | trans-(2R,6S)-6-azido-2-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexan-1-ol |
| PubChem CID | 161192678 |
| Molecular Formula | C13H27N3O2Si |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | trans-(2R,6S)-6-azido-2-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@]1(C)CCC[C@H](N=[N+]=[N-])C1O |
| InChI | InChI=1S/C13H27N3O2Si/c1-12(2,3)19(5,6)18-13(4)9-7-8-10(11(13)17)15-16-14/h10-11,17H,7-9H2,1-6H3/t10-,11?,13+/m0/s1 |
| InChIKey | CSWAEAIYVKYICA-CCQDYZPNSA-N |
| XLogP | 3.99 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze trans-(2R,6S)-6-azido-2-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(2R,6S)-6-azido-2-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexan-1-ol?
The IUPAC name of trans-(2R,6S)-6-azido-2-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexan-1-ol (CID 161192678) is trans-(2R,6S)-6-azido-2-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexan-1-ol.
What is the SMILES notation for trans-(2R,6S)-6-azido-2-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexan-1-ol?
The canonical SMILES for trans-(2R,6S)-6-azido-2-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexan-1-ol is CC(C)(C)[Si](C)(C)O[C@]1(C)CCC[C@H](N=[N+]=[N-])C1O.
What is the InChIKey of trans-(2R,6S)-6-azido-2-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexan-1-ol?
The InChIKey is CSWAEAIYVKYICA-CCQDYZPNSA-N. The full InChI is InChI=1S/C13H27N3O2Si/c1-12(2,3)19(5,6)18-13(4)9-7-8-10(11(13)17)15-16-14/h10-11,17H,7-9H2,1-6H3/t10-,11?,13+/m0/s1.
What are the key properties of trans-(2R,6S)-6-azido-2-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexan-1-ol?
trans-(2R,6S)-6-azido-2-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexan-1-ol has a molecular weight of 285.46 g/mol, XLogP of 3.99, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(2R,6S)-6-azido-2-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexan-1-ol is sourced from PubChem (CID 161192678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).