C13H27N3O2Si — CID 123169753
[(1R,2S,6R)-2-azido-6-methoxycyclohexyl]oxy-tert-butyl-dimethylsilane (PubChem CID 123169753) has the molecular formula C13H27N3O2Si and a molecular weight of 285.46 g/mol. Its IUPAC name is [(1R,2S,6R)-2-azido-6-methoxycyclohexyl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,2S,6R)-2-azido-6-methoxycyclohexyl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 123169753 |
| Molecular Formula | C13H27N3O2Si |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | [(1R,2S,6R)-2-azido-6-methoxycyclohexyl]oxy-tert-butyl-dimethylsilane |
| SMILES | CO[C@@H]1CCC[C@H](N=[N+]=[N-])[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H27N3O2Si/c1-13(2,3)19(5,6)18-12-10(15-16-14)8-7-9-11(12)17-4/h10-12H,7-9H2,1-6H3/t10-,11+,12+/m0/s1 |
| InChIKey | LBLBVZPWMJSSEO-QJPTWQEYSA-N |
| XLogP | 4.25 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|