C13H29NO2Si — CID 67291290
2-[tert-butyl(dimethyl)silyl]oxy-3-methoxycyclohexan-1-amine (PubChem CID 67291290) has the molecular formula C13H29NO2Si and a molecular weight of 259.47 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-3-methoxycyclohexan-1-amine.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-3-methoxycyclohexan-1-amine |
|---|---|
| PubChem CID | 67291290 |
| Molecular Formula | C13H29NO2Si |
| Molecular Weight | 259.47 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-3-methoxycyclohexan-1-amine |
| SMILES | COC1CCCC(N)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H29NO2Si/c1-13(2,3)17(5,6)16-12-10(14)8-7-9-11(12)15-4/h10-12H,7-9,14H2,1-6H3 |
| InChIKey | LPYFYFKEPNIPTE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|