C16H34OSi2 — CID 102254534
tert-butyl-dimethyl-[(1S,2S)-2-(1-trimethylsilylethenyl)cyclopentyl]oxysilane (PubChem CID 102254534) has the molecular formula C16H34OSi2 and a molecular weight of 298.62 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1S,2S)-2-(1-trimethylsilylethenyl)cyclopentyl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1S,2S)-2-(1-trimethylsilylethenyl)cyclopentyl]oxysilane |
|---|---|
| PubChem CID | 102254534 |
| Molecular Formula | C16H34OSi2 |
| Molecular Weight | 298.62 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | tert-butyl-dimethyl-[(1S,2S)-2-(1-trimethylsilylethenyl)cyclopentyl]oxysilane |
| SMILES | C=C([C@H]1CCC[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C16H34OSi2/c1-13(18(5,6)7)14-11-10-12-15(14)17-19(8,9)16(2,3)4/h14-15H,1,10-12H2,2-9H3/t14-,15+/m1/s1 |
| InChIKey | MYJDDEKMCDFAHP-CABCVRRESA-N |
| XLogP | 5.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.62 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|