C12H24O3SSi — CID 11680675
(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxythiane-3-carboxylic acid (PubChem CID 11680675) has the molecular formula C12H24O3SSi and a molecular weight of 276.47 g/mol. Its IUPAC name is (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxythiane-3-carboxylic acid.
| Compound Name | (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxythiane-3-carboxylic acid |
|---|---|
| PubChem CID | 11680675 |
| Molecular Formula | C12H24O3SSi |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxythiane-3-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCSC[C@H]1C(=O)O |
| InChI | InChI=1S/C12H24O3SSi/c1-12(2,3)17(4,5)15-10-6-7-16-8-9(10)11(13)14/h9-10H,6-8H2,1-5H3,(H,13,14)/t9-,10+/m1/s1 |
| InChIKey | ZYKZEHGACJDPLQ-ZJUUUORDSA-N |
| XLogP | 3.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|