About tert-butyl-[(1S,2R)-2-[(E)-1-iodoprop-1-en-2-yl]cyclohexyl]oxy-dimethylsilane
tert-butyl-[(1S,2R)-2-[(E)-1-iodoprop-1-en-2-yl]cyclohexyl]oxy-dimethylsilane (PubChem CID 71619673) has the molecular formula C15H29IOSi
and a molecular weight of 380.39 g/mol. Its IUPAC name is tert-butyl-[(1S,2R)-2-[(E)-1-iodoprop-1-en-2-yl]cyclohexyl]oxy-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(1S,2R)-2-[(E)-1-iodoprop-1-en-2-yl]cyclohexyl]oxy-dimethylsilane |
| PubChem CID | 71619673 |
| Molecular Formula | C15H29IOSi |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | tert-butyl-[(1S,2R)-2-[(E)-1-iodoprop-1-en-2-yl]cyclohexyl]oxy-dimethylsilane |
| SMILES | C/C(=C\I)[C@H]1CCCC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H29IOSi/c1-12(11-16)13-9-7-8-10-14(13)17-18(5,6)15(2,3)4/h11,13-14H,7-10H2,1-6H3/b12-11+/t13-,14+/m1/s1 |
| InChIKey | UNQDAHBMLFSWGS-WLDGIZNKSA-N |
| XLogP | 5.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(1S,2R)-2-[(E)-1-iodoprop-1-en-2-yl]cyclohexyl]oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(1S,2R)-2-[(E)-1-iodoprop-1-en-2-yl]cyclohexyl]oxy-dimethylsilane?
The IUPAC name of tert-butyl-[(1S,2R)-2-[(E)-1-iodoprop-1-en-2-yl]cyclohexyl]oxy-dimethylsilane (CID 71619673) is tert-butyl-[(1S,2R)-2-[(E)-1-iodoprop-1-en-2-yl]cyclohexyl]oxy-dimethylsilane.
What is the SMILES notation for tert-butyl-[(1S,2R)-2-[(E)-1-iodoprop-1-en-2-yl]cyclohexyl]oxy-dimethylsilane?
The canonical SMILES for tert-butyl-[(1S,2R)-2-[(E)-1-iodoprop-1-en-2-yl]cyclohexyl]oxy-dimethylsilane is C/C(=C\I)[C@H]1CCCC[C@@H]1O[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-[(1S,2R)-2-[(E)-1-iodoprop-1-en-2-yl]cyclohexyl]oxy-dimethylsilane?
The InChIKey is UNQDAHBMLFSWGS-WLDGIZNKSA-N. The full InChI is InChI=1S/C15H29IOSi/c1-12(11-16)13-9-7-8-10-14(13)17-18(5,6)15(2,3)4/h11,13-14H,7-10H2,1-6H3/b12-11+/t13-,14+/m1/s1.
What are the key properties of tert-butyl-[(1S,2R)-2-[(E)-1-iodoprop-1-en-2-yl]cyclohexyl]oxy-dimethylsilane?
tert-butyl-[(1S,2R)-2-[(E)-1-iodoprop-1-en-2-yl]cyclohexyl]oxy-dimethylsilane has a molecular weight of 380.39 g/mol, XLogP of 5.91, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(1S,2R)-2-[(E)-1-iodoprop-1-en-2-yl]cyclohexyl]oxy-dimethylsilane is sourced from PubChem (CID 71619673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).