C15H29IOSi — CID 71619673
tert-butyl-[(1S,2R)-2-[(E)-1-iodoprop-1-en-2-yl]cyclohexyl]oxy-dimethylsilane (PubChem CID 71619673) has the molecular formula C15H29IOSi and a molecular weight of 380.39 g/mol. Its IUPAC name is tert-butyl-[(1S,2R)-2-[(E)-1-iodoprop-1-en-2-yl]cyclohexyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1S,2R)-2-[(E)-1-iodoprop-1-en-2-yl]cyclohexyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 71619673 |
| Molecular Formula | C15H29IOSi |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | tert-butyl-[(1S,2R)-2-[(E)-1-iodoprop-1-en-2-yl]cyclohexyl]oxy-dimethylsilane |
| SMILES | C/C(=C\I)[C@H]1CCCC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H29IOSi/c1-12(11-16)13-9-7-8-10-14(13)17-18(5,6)15(2,3)4/h11,13-14H,7-10H2,1-6H3/b12-11+/t13-,14+/m1/s1 |
| InChIKey | UNQDAHBMLFSWGS-WLDGIZNKSA-N |
| XLogP | 5.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|