C16H32O3Si — CID 141177675
methyl 2-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]propanoate (PubChem CID 141177675) has the molecular formula C16H32O3Si and a molecular weight of 300.51 g/mol. Its IUPAC name is methyl 2-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]propanoate.
| Compound Name | methyl 2-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]propanoate |
|---|---|
| PubChem CID | 141177675 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | methyl 2-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]propanoate |
| SMILES | COC(=O)C(C)[C@@H]1CCCC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O3Si/c1-12(15(17)18-5)13-10-8-9-11-14(13)19-20(6,7)16(2,3)4/h12-14H,8-11H2,1-7H3/t12?,13-,14+/m0/s1 |
| InChIKey | FDOGOMDRVIQSIY-KFTPUPIBSA-N |
| XLogP | 4.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|