C13H27NO3Si — CID 67282800
(2S,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1,3-dimethylpyrrolidine-2-carboxylic acid (PubChem CID 67282800) has the molecular formula C13H27NO3Si and a molecular weight of 273.45 g/mol. Its IUPAC name is (2S,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1,3-dimethylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1,3-dimethylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 67282800 |
| Molecular Formula | C13H27NO3Si |
| Molecular Weight | 273.45 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | (2S,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1,3-dimethylpyrrolidine-2-carboxylic acid |
| SMILES | C[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CN(C)[C@@H]1C(=O)O |
| InChI | InChI=1S/C13H27NO3Si/c1-9-10(8-14(5)11(9)12(15)16)17-18(6,7)13(2,3)4/h9-11H,8H2,1-7H3,(H,15,16)/t9-,10+,11+/m1/s1 |
| InChIKey | FTJUDVJCNNXEBD-VWYCJHECSA-N |
| XLogP | 2.41 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|