C12H25NO2Si — CID 91297949
(3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1,3-dimethylpyrrolidin-2-one (PubChem CID 91297949) has the molecular formula C12H25NO2Si and a molecular weight of 243.42 g/mol. Its IUPAC name is (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1,3-dimethylpyrrolidin-2-one.
| Compound Name | (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1,3-dimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 91297949 |
| Molecular Formula | C12H25NO2Si |
| Molecular Weight | 243.42 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1,3-dimethylpyrrolidin-2-one |
| SMILES | C[C@@H]1C(=O)N(C)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H25NO2Si/c1-9-10(8-13(5)11(9)14)15-16(6,7)12(2,3)4/h9-10H,8H2,1-7H3/t9-,10+/m0/s1 |
| InChIKey | QNYQREHOXOJKCE-VHSXEESVSA-N |
| XLogP | 2.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|