C13H27NO2Si — CID 69203284
3-[tert-butyl(dimethyl)silyl]oxy-1,4,4-trimethylpyrrolidin-2-one (PubChem CID 69203284) has the molecular formula C13H27NO2Si and a molecular weight of 257.45 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-1,4,4-trimethylpyrrolidin-2-one.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-1,4,4-trimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 69203284 |
| Molecular Formula | C13H27NO2Si |
| Molecular Weight | 257.45 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-1,4,4-trimethylpyrrolidin-2-one |
| SMILES | CN1CC(C)(C)C(O[Si](C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C13H27NO2Si/c1-12(2,3)17(7,8)16-10-11(15)14(6)9-13(10,4)5/h10H,9H2,1-8H3 |
| InChIKey | KFNSDLSRQNCPFE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|