C14H28OSSi — CID 102246926
tert-butyl-(5,5-dimethyl-2-methylsulfanylcyclopent-2-en-1-yl)oxy-dimethylsilane (PubChem CID 102246926) has the molecular formula C14H28OSSi and a molecular weight of 272.53 g/mol. Its IUPAC name is tert-butyl-(5,5-dimethyl-2-methylsulfanylcyclopent-2-en-1-yl)oxy-dimethylsilane.
| Compound Name | tert-butyl-(5,5-dimethyl-2-methylsulfanylcyclopent-2-en-1-yl)oxy-dimethylsilane |
|---|---|
| PubChem CID | 102246926 |
| Molecular Formula | C14H28OSSi |
| Molecular Weight | 272.53 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | tert-butyl-(5,5-dimethyl-2-methylsulfanylcyclopent-2-en-1-yl)oxy-dimethylsilane |
| SMILES | CSC1=CCC(C)(C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H28OSSi/c1-13(2,3)17(7,8)15-12-11(16-6)9-10-14(12,4)5/h9,12H,10H2,1-8H3 |
| InChIKey | DTGKWYZLEMZIFO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|