C12H23ClOSi — CID 10658111
tert-butyl-[(1R,4R)-4-chlorocyclohex-2-en-1-yl]oxy-dimethylsilane (PubChem CID 10658111) has the molecular formula C12H23ClOSi and a molecular weight of 246.85 g/mol. Its IUPAC name is tert-butyl-[(1R,4R)-4-chlorocyclohex-2-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1R,4R)-4-chlorocyclohex-2-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10658111 |
| Molecular Formula | C12H23ClOSi |
| Molecular Weight | 246.85 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | tert-butyl-[(1R,4R)-4-chlorocyclohex-2-en-1-yl]oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H](Cl)CC1 |
| InChI | InChI=1S/C12H23ClOSi/c1-12(2,3)15(4,5)14-11-8-6-10(13)7-9-11/h6,8,10-11H,7,9H2,1-5H3/t10-,11-/m0/s1 |
| InChIKey | AKQJECWARDOTDJ-QWRGUYRKSA-N |
| XLogP | 4.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.85 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|