C14H28OSi — CID 12568500
tert-butyl-[(2Z)-cyclooct-2-en-1-yl]oxy-dimethylsilane (PubChem CID 12568500) has the molecular formula C14H28OSi and a molecular weight of 240.46 g/mol. Its IUPAC name is tert-butyl-[(2Z)-cyclooct-2-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2Z)-cyclooct-2-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 12568500 |
| Molecular Formula | C14H28OSi |
| Molecular Weight | 240.46 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | tert-butyl-[(2Z)-cyclooct-2-en-1-yl]oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1/C=C\CCCCC1 |
| InChI | InChI=1S/C14H28OSi/c1-14(2,3)16(4,5)15-13-11-9-7-6-8-10-12-13/h9,11,13H,6-8,10,12H2,1-5H3/b11-9- |
| InChIKey | RQFXLNCIDGJIGD-LUAWRHEFSA-N |
| XLogP | 4.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|