C15H24O2 — CID 141430712
3-(2-cyclohex-2-en-1-yloxypropan-2-yloxy)cyclohexene (PubChem CID 141430712) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 3-(2-cyclohex-2-en-1-yloxypropan-2-yloxy)cyclohexene.
| Compound Name | 3-(2-cyclohex-2-en-1-yloxypropan-2-yloxy)cyclohexene |
|---|---|
| PubChem CID | 141430712 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 3-(2-cyclohex-2-en-1-yloxypropan-2-yloxy)cyclohexene |
| SMILES | CC(C)(OC1C=CCCC1)OC1C=CCCC1 |
| InChI | InChI=1S/C15H24O2/c1-15(2,16-13-9-5-3-6-10-13)17-14-11-7-4-8-12-14/h5,7,9,11,13-14H,3-4,6,8,10,12H2,1-2H3 |
| InChIKey | YMYFAEWPLSPING-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|