C16H32OSi — CID 68820963
tert-butyl-cyclodec-2-en-1-yloxy-dimethylsilane (PubChem CID 68820963) has the molecular formula C16H32OSi and a molecular weight of 268.52 g/mol. Its IUPAC name is tert-butyl-cyclodec-2-en-1-yloxy-dimethylsilane.
| Compound Name | tert-butyl-cyclodec-2-en-1-yloxy-dimethylsilane |
|---|---|
| PubChem CID | 68820963 |
| Molecular Formula | C16H32OSi |
| Molecular Weight | 268.52 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | tert-butyl-cyclodec-2-en-1-yloxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1C=CCCCCCCC1 |
| InChI | InChI=1S/C16H32OSi/c1-16(2,3)18(4,5)17-15-13-11-9-7-6-8-10-12-14-15/h11,13,15H,6-10,12,14H2,1-5H3 |
| InChIKey | NBTSPIZKJITDHH-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.52 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|