C15H31IO2Si2 — CID 11026310
tert-butyl-(3-iodo-4-trimethylsilyloxycyclohex-2-en-1-yl)oxy-dimethylsilane (PubChem CID 11026310) has the molecular formula C15H31IO2Si2 and a molecular weight of 426.49 g/mol. Its IUPAC name is tert-butyl-(3-iodo-4-trimethylsilyloxycyclohex-2-en-1-yl)oxy-dimethylsilane.
| Compound Name | tert-butyl-(3-iodo-4-trimethylsilyloxycyclohex-2-en-1-yl)oxy-dimethylsilane |
|---|---|
| PubChem CID | 11026310 |
| Molecular Formula | C15H31IO2Si2 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | tert-butyl-(3-iodo-4-trimethylsilyloxycyclohex-2-en-1-yl)oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1C=C(I)C(O[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C15H31IO2Si2/c1-15(2,3)20(7,8)17-12-9-10-14(13(16)11-12)18-19(4,5)6/h11-12,14H,9-10H2,1-8H3 |
| InChIKey | MXAPDYCPBQYKLA-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|