C11H20BrIOSi — CID 11697037
(3-bromo-2-iodocyclopent-2-en-1-yl)oxy-tert-butyl-dimethylsilane (PubChem CID 11697037) has the molecular formula C11H20BrIOSi and a molecular weight of 403.17 g/mol. Its IUPAC name is (3-bromo-2-iodocyclopent-2-en-1-yl)oxy-tert-butyl-dimethylsilane.
| Compound Name | (3-bromo-2-iodocyclopent-2-en-1-yl)oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11697037 |
| Molecular Formula | C11H20BrIOSi |
| Molecular Weight | 403.17 g/mol |
| Exact Mass | 401.95 |
| IUPAC Name | (3-bromo-2-iodocyclopent-2-en-1-yl)oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(Br)=C1I |
| InChI | InChI=1S/C11H20BrIOSi/c1-11(2,3)15(4,5)14-9-7-6-8(12)10(9)13/h9H,6-7H2,1-5H3 |
| InChIKey | XNFZYPQZNSLUJM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.17 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|