C15H23BrO2Si — CID 125117332
[(4R)-6-bromo-3,4-dihydro-2H-chromen-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 125117332) has the molecular formula C15H23BrO2Si and a molecular weight of 343.34 g/mol. Its IUPAC name is [(4R)-6-bromo-3,4-dihydro-2H-chromen-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(4R)-6-bromo-3,4-dihydro-2H-chromen-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 125117332 |
| Molecular Formula | C15H23BrO2Si |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | [(4R)-6-bromo-3,4-dihydro-2H-chromen-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCOc2ccc(Br)cc21 |
| InChI | InChI=1S/C15H23BrO2Si/c1-15(2,3)19(4,5)18-14-8-9-17-13-7-6-11(16)10-12(13)14/h6-7,10,14H,8-9H2,1-5H3/t14-/m1/s1 |
| InChIKey | YMWUULTZIYURCW-CQSZACIVSA-N |
| XLogP | 5.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|