C13H18BrNOS — CID 166094073
6-bromo-N-tert-butylsulfanyl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 166094073) has the molecular formula C13H18BrNOS and a molecular weight of 316.26 g/mol. Its IUPAC name is 6-bromo-N-tert-butylsulfanyl-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 6-bromo-N-tert-butylsulfanyl-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 166094073 |
| Molecular Formula | C13H18BrNOS |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 6-bromo-N-tert-butylsulfanyl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CC(C)(C)SNC1CCOc2ccc(Br)cc21 |
| InChI | InChI=1S/C13H18BrNOS/c1-13(2,3)17-15-11-6-7-16-12-5-4-9(14)8-10(11)12/h4-5,8,11,15H,6-7H2,1-3H3 |
| InChIKey | NWIJHDZCBPPJES-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|