C15H12Br3NO — CID 107597702
6-bromo-N-(2,6-dibromophenyl)-3,4-dihydro-2H-chromen-4-amine (PubChem CID 107597702) has the molecular formula C15H12Br3NO and a molecular weight of 461.98 g/mol. Its IUPAC name is 6-bromo-N-(2,6-dibromophenyl)-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 6-bromo-N-(2,6-dibromophenyl)-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 107597702 |
| Molecular Formula | C15H12Br3NO |
| Molecular Weight | 461.98 g/mol |
| Exact Mass | 458.85 |
| IUPAC Name | 6-bromo-N-(2,6-dibromophenyl)-3,4-dihydro-2H-chromen-4-amine |
| SMILES | Brc1ccc2c(c1)C(Nc1c(Br)cccc1Br)CCO2 |
| InChI | InChI=1S/C15H12Br3NO/c16-9-4-5-14-10(8-9)13(6-7-20-14)19-15-11(17)2-1-3-12(15)18/h1-5,8,13,19H,6-7H2 |
| InChIKey | HUGMZFUQYRTBJQ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.98 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |