C17H14BrNO — CID 43755539
6-bromo-N-(3-ethynylphenyl)-3,4-dihydro-2H-chromen-4-amine (PubChem CID 43755539) has the molecular formula C17H14BrNO and a molecular weight of 328.21 g/mol. Its IUPAC name is 6-bromo-N-(3-ethynylphenyl)-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 6-bromo-N-(3-ethynylphenyl)-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 43755539 |
| Molecular Formula | C17H14BrNO |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 6-bromo-N-(3-ethynylphenyl)-3,4-dihydro-2H-chromen-4-amine |
| SMILES | C#Cc1cccc(NC2CCOc3ccc(Br)cc32)c1 |
| InChI | InChI=1S/C17H14BrNO/c1-2-12-4-3-5-14(10-12)19-16-8-9-20-17-7-6-13(18)11-15(16)17/h1,3-7,10-11,16,19H,8-9H2 |
| InChIKey | YNSDQKMWHRHQPN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|