C16H16BrNO2 — CID 107700924
5-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-2-methylphenol (PubChem CID 107700924) has the molecular formula C16H16BrNO2 and a molecular weight of 334.21 g/mol. Its IUPAC name is 5-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-2-methylphenol.
| Compound Name | 5-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-2-methylphenol |
|---|---|
| PubChem CID | 107700924 |
| Molecular Formula | C16H16BrNO2 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 5-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-2-methylphenol |
| SMILES | Cc1ccc(NC2CCOc3ccc(Br)cc32)cc1O |
| InChI | InChI=1S/C16H16BrNO2/c1-10-2-4-12(9-15(10)19)18-14-6-7-20-16-5-3-11(17)8-13(14)16/h2-5,8-9,14,18-19H,6-7H2,1H3 |
| InChIKey | LHNZXRLRIZMYJL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |