C19H19NO — CID 43755542
N-(3-ethynylphenyl)-9-methyl-2,3,4,5-tetrahydro-1-benzoxepin-5-amine (PubChem CID 43755542) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-9-methyl-2,3,4,5-tetrahydro-1-benzoxepin-5-amine.
| Compound Name | N-(3-ethynylphenyl)-9-methyl-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
|---|---|
| PubChem CID | 43755542 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | N-(3-ethynylphenyl)-9-methyl-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
| SMILES | C#Cc1cccc(NC2CCCOc3c(C)cccc32)c1 |
| InChI | InChI=1S/C19H19NO/c1-3-15-8-5-9-16(13-15)20-18-11-6-12-21-19-14(2)7-4-10-17(18)19/h1,4-5,7-10,13,18,20H,6,11-12H2,2H3 |
| InChIKey | ZLLMJLVQBZAFOC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|