C17H15NO — CID 43636895
1-(3-ethynylanilino)-2,3-dihydro-1H-inden-4-ol (PubChem CID 43636895) has the molecular formula C17H15NO and a molecular weight of 249.31 g/mol. Its IUPAC name is 1-(3-ethynylanilino)-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 1-(3-ethynylanilino)-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 43636895 |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 1-(3-ethynylanilino)-2,3-dihydro-1H-inden-4-ol |
| SMILES | C#Cc1cccc(NC2CCc3c(O)cccc32)c1 |
| InChI | InChI=1S/C17H15NO/c1-2-12-5-3-6-13(11-12)18-16-10-9-15-14(16)7-4-8-17(15)19/h1,3-8,11,16,18-19H,9-10H2 |
| InChIKey | UXLACYUUQZHUCB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|