C15H14INO — CID 43637127
1-(4-iodoanilino)-2,3-dihydro-1H-inden-4-ol (PubChem CID 43637127) has the molecular formula C15H14INO and a molecular weight of 351.19 g/mol. Its IUPAC name is 1-(4-iodoanilino)-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 1-(4-iodoanilino)-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 43637127 |
| Molecular Formula | C15H14INO |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 1-(4-iodoanilino)-2,3-dihydro-1H-inden-4-ol |
| SMILES | Oc1cccc2c1CCC2Nc1ccc(I)cc1 |
| InChI | InChI=1S/C15H14INO/c16-10-4-6-11(7-5-10)17-14-9-8-13-12(14)2-1-3-15(13)18/h1-7,14,17-18H,8-9H2 |
| InChIKey | AFYKCFDTJMUFDN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|