C15H13ClFN — CID 83067484
N-(4-chlorophenyl)-4-fluoro-2,3-dihydro-1H-inden-1-amine (PubChem CID 83067484) has the molecular formula C15H13ClFN and a molecular weight of 261.73 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-fluoro-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-(4-chlorophenyl)-4-fluoro-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 83067484 |
| Molecular Formula | C15H13ClFN |
| Molecular Weight | 261.73 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | N-(4-chlorophenyl)-4-fluoro-2,3-dihydro-1H-inden-1-amine |
| SMILES | Fc1cccc2c1CCC2Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H13ClFN/c16-10-4-6-11(7-5-10)18-15-9-8-12-13(15)2-1-3-14(12)17/h1-7,15,18H,8-9H2 |
| InChIKey | PSPLCRSIKSOIGN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.73 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |