C17H24FN — CID 83065945
N-cyclooctyl-4-fluoro-2,3-dihydro-1H-inden-1-amine (PubChem CID 83065945) has the molecular formula C17H24FN and a molecular weight of 261.38 g/mol. Its IUPAC name is N-cyclooctyl-4-fluoro-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-cyclooctyl-4-fluoro-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 83065945 |
| Molecular Formula | C17H24FN |
| Molecular Weight | 261.38 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | N-cyclooctyl-4-fluoro-2,3-dihydro-1H-inden-1-amine |
| SMILES | Fc1cccc2c1CCC2NC1CCCCCCC1 |
| InChI | InChI=1S/C17H24FN/c18-16-10-6-9-15-14(16)11-12-17(15)19-13-7-4-2-1-3-5-8-13/h6,9-10,13,17,19H,1-5,7-8,11-12H2 |
| InChIKey | IMSQGGPHNJSHHL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |